C14H24N4O2S — CID 114414060
3-[4-(3,6-dihydro-2H-pyridin-1-ylsulfonyl)-3,5-dimethylpyrazol-1-yl]-N-methylpropan-1-amine (PubChem CID 114414060) has the molecular formula C14H24N4O2S and a molecular weight of 312.44 g/mol. Its IUPAC name is 3-[4-(3,6-dihydro-2H-pyridin-1-ylsulfonyl)-3,5-dimethylpyrazol-1-yl]-N-methylpropan-1-amine.
| Compound Name | 3-[4-(3,6-dihydro-2H-pyridin-1-ylsulfonyl)-3,5-dimethylpyrazol-1-yl]-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 114414060 |
| Molecular Formula | C14H24N4O2S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 3-[4-(3,6-dihydro-2H-pyridin-1-ylsulfonyl)-3,5-dimethylpyrazol-1-yl]-N-methylpropan-1-amine |
| SMILES | CNCCCn1nc(C)c(S(=O)(=O)N2CC=CCC2)c1C |
| InChI | InChI=1S/C14H24N4O2S/c1-12-14(13(2)18(16-12)11-7-8-15-3)21(19,20)17-9-5-4-6-10-17/h4-5,15H,6-11H2,1-3H3 |
| InChIKey | XAUUUPQYYWHMIF-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|