C10H20N2O — CID 114416015
2-N-but-3-yn-2-yl-4-methoxy-3-methylbutane-1,2-diamine (PubChem CID 114416015) has the molecular formula C10H20N2O and a molecular weight of 184.28 g/mol. Its IUPAC name is 2-N-but-3-yn-2-yl-4-methoxy-3-methylbutane-1,2-diamine.
| Compound Name | 2-N-but-3-yn-2-yl-4-methoxy-3-methylbutane-1,2-diamine |
|---|---|
| PubChem CID | 114416015 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | 2-N-but-3-yn-2-yl-4-methoxy-3-methylbutane-1,2-diamine |
| SMILES | C#CC(C)NC(CN)C(C)COC |
| InChI | InChI=1S/C10H20N2O/c1-5-9(3)12-10(6-11)8(2)7-13-4/h1,8-10,12H,6-7,11H2,2-4H3 |
| InChIKey | ALTYMEFCBVVKSK-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|