C13H17N3O3S — CID 114417466
3-[2-(but-3-yn-2-ylamino)ethylsulfonyl]-N'-hydroxybenzenecarboximidamide (PubChem CID 114417466) has the molecular formula C13H17N3O3S and a molecular weight of 295.36 g/mol. Its IUPAC name is 3-[2-(but-3-yn-2-ylamino)ethylsulfonyl]-N'-hydroxybenzenecarboximidamide.
| Compound Name | 3-[2-(but-3-yn-2-ylamino)ethylsulfonyl]-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 114417466 |
| Molecular Formula | C13H17N3O3S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 3-[2-(but-3-yn-2-ylamino)ethylsulfonyl]-N'-hydroxybenzenecarboximidamide |
| SMILES | C#CC(C)NCCS(=O)(=O)c1cccc(/C(N)=N/O)c1 |
| InChI | InChI=1S/C13H17N3O3S/c1-3-10(2)15-7-8-20(18,19)12-6-4-5-11(9-12)13(14)16-17/h1,4-6,9-10,15,17H,7-8H2,2H3,(H2,14,16) |
| InChIKey | KVRZIHWXFJMMES-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 104.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|