C16H17N3O2 — CID 114420896
4'-amino-1'-but-3-yn-2-yl-3-methylspiro[2,3-dihydrochromene-4,5'-imidazole]-2'-one (PubChem CID 114420896) has the molecular formula C16H17N3O2 and a molecular weight of 283.33 g/mol. Its IUPAC name is 4'-amino-1'-but-3-yn-2-yl-3-methylspiro[2,3-dihydrochromene-4,5'-imidazole]-2'-one.
| Compound Name | 4'-amino-1'-but-3-yn-2-yl-3-methylspiro[2,3-dihydrochromene-4,5'-imidazole]-2'-one |
|---|---|
| PubChem CID | 114420896 |
| Molecular Formula | C16H17N3O2 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | 4'-amino-1'-but-3-yn-2-yl-3-methylspiro[2,3-dihydrochromene-4,5'-imidazole]-2'-one |
| SMILES | C#CC(C)N1C(=O)N=C(N)C12c1ccccc1OCC2C |
| InChI | InChI=1S/C16H17N3O2/c1-4-11(3)19-15(20)18-14(17)16(19)10(2)9-21-13-8-6-5-7-12(13)16/h1,5-8,10-11H,9H2,2-3H3,(H2,17,18,20) |
| InChIKey | MJLYDHCRLJOLTK-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|