C15H15N3O — CID 114420730
4'-amino-1'-but-3-yn-2-ylspiro[1,3-dihydroindene-2,5'-imidazole]-2'-one (PubChem CID 114420730) has the molecular formula C15H15N3O and a molecular weight of 253.31 g/mol. Its IUPAC name is 4'-amino-1'-but-3-yn-2-ylspiro[1,3-dihydroindene-2,5'-imidazole]-2'-one.
| Compound Name | 4'-amino-1'-but-3-yn-2-ylspiro[1,3-dihydroindene-2,5'-imidazole]-2'-one |
|---|---|
| PubChem CID | 114420730 |
| Molecular Formula | C15H15N3O |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 4'-amino-1'-but-3-yn-2-ylspiro[1,3-dihydroindene-2,5'-imidazole]-2'-one |
| SMILES | C#CC(C)N1C(=O)N=C(N)C12Cc1ccccc1C2 |
| InChI | InChI=1S/C15H15N3O/c1-3-10(2)18-14(19)17-13(16)15(18)8-11-6-4-5-7-12(11)9-15/h1,4-7,10H,8-9H2,2H3,(H2,16,17,19) |
| InChIKey | RSCQZXUEWAPJTK-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|