C28H32O3S2 — CID 11443023
2-[(R)-tert-butylsulfinyl]sulfanyl-2-methylpropane;1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol (PubChem CID 11443023) has the molecular formula C28H32O3S2 and a molecular weight of 480.70 g/mol. Its IUPAC name is 2-[(R)-tert-butylsulfinyl]sulfanyl-2-methylpropane;1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol.
| Compound Name | 2-[(R)-tert-butylsulfinyl]sulfanyl-2-methylpropane;1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol |
|---|---|
| PubChem CID | 11443023 |
| Molecular Formula | C28H32O3S2 |
| Molecular Weight | 480.70 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | 2-[(R)-tert-butylsulfinyl]sulfanyl-2-methylpropane;1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol |
| SMILES | CC(C)(C)S[S@@](=O)C(C)(C)C.Oc1ccc2ccccc2c1-c1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C20H14O2.C8H18OS2/c21-17-11-9-13-5-1-3-7-15(13)19(17)20-16-8-4-2-6-14(16)10-12-18(20)22;1-7(2,3)10-11(9)8(4,5)6/h1-12,21-22H;1-6H3/t;11-/m.1/s1 |
| InChIKey | GMGGHIURVXVTJP-HVZQFPCNSA-N |
| XLogP | 8.05 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.70 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|