C36H34O2Si — CID 175202561
tert-butyl(diphenyl)silane;1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol (PubChem CID 175202561) has the molecular formula C36H34O2Si and a molecular weight of 526.75 g/mol. Its IUPAC name is tert-butyl(diphenyl)silane;1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol.
| Compound Name | tert-butyl(diphenyl)silane;1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol |
|---|---|
| PubChem CID | 175202561 |
| Molecular Formula | C36H34O2Si |
| Molecular Weight | 526.75 g/mol |
| Exact Mass | 526.23 |
| IUPAC Name | tert-butyl(diphenyl)silane;1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol |
| SMILES | CC(C)(C)[SiH](c1ccccc1)c1ccccc1.Oc1ccc2ccccc2c1-c1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C20H14O2.C16H20Si/c21-17-11-9-13-5-1-3-7-15(13)19(17)20-16-8-4-2-6-14(16)10-12-18(20)22;1-16(2,3)17(14-10-6-4-7-11-14)15-12-8-5-9-13-15/h1-12,21-22H;4-13,17H,1-3H3 |
| InChIKey | YCAHVTDYIUDVRH-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.75 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|