C28H32Cl2N4O4 — CID 11444352
6-cyclopentyl-6-[2-(3,5-dichloro-4-ethoxyphenyl)ethyl]-3-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]oxane-2,4-dione (PubChem CID 11444352) has the molecular formula C28H32Cl2N4O4 and a molecular weight of 559.49 g/mol. Its IUPAC name is 6-cyclopentyl-6-[2-(3,5-dichloro-4-ethoxyphenyl)ethyl]-3-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]oxane-2,4-dione.
| Compound Name | 6-cyclopentyl-6-[2-(3,5-dichloro-4-ethoxyphenyl)ethyl]-3-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]oxane-2,4-dione |
|---|---|
| PubChem CID | 11444352 |
| Molecular Formula | C28H32Cl2N4O4 |
| Molecular Weight | 559.49 g/mol |
| Exact Mass | 558.18 |
| IUPAC Name | 6-cyclopentyl-6-[2-(3,5-dichloro-4-ethoxyphenyl)ethyl]-3-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]oxane-2,4-dione |
| SMILES | CCOc1c(Cl)cc(CCC2(C3CCCC3)CC(=O)C(Cc3nc4nc(C)cc(C)n4n3)C(=O)O2)cc1Cl |
| InChI | InChI=1S/C28H32Cl2N4O4/c1-4-37-25-21(29)12-18(13-22(25)30)9-10-28(19-7-5-6-8-19)15-23(35)20(26(36)38-28)14-24-32-27-31-16(2)11-17(3)34(27)33-24/h11-13,19-20H,4-10,14-15H2,1-3H3 |
| InChIKey | BXNOTAJEGCFHLX-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 95.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.49 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|