C11H9ClF3N3S — CID 114450295
N-[[3-(chloromethyl)phenyl]methyl]-5-(trifluoromethyl)-1,3,4-thiadiazol-2-amine (PubChem CID 114450295) has the molecular formula C11H9ClF3N3S and a molecular weight of 307.73 g/mol. Its IUPAC name is N-[[3-(chloromethyl)phenyl]methyl]-5-(trifluoromethyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | N-[[3-(chloromethyl)phenyl]methyl]-5-(trifluoromethyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 114450295 |
| Molecular Formula | C11H9ClF3N3S |
| Molecular Weight | 307.73 g/mol |
| Exact Mass | 307.02 |
| IUPAC Name | N-[[3-(chloromethyl)phenyl]methyl]-5-(trifluoromethyl)-1,3,4-thiadiazol-2-amine |
| SMILES | FC(F)(F)c1nnc(NCc2cccc(CCl)c2)s1 |
| InChI | InChI=1S/C11H9ClF3N3S/c12-5-7-2-1-3-8(4-7)6-16-10-18-17-9(19-10)11(13,14)15/h1-4H,5-6H2,(H,16,18) |
| InChIKey | CXTPHQYBDFFLRS-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.73 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|