C16H21FO3S — CID 114450499
methyl 4-[2-(4-fluorophenyl)sulfanylethoxy]cyclohexane-1-carboxylate (PubChem CID 114450499) has the molecular formula C16H21FO3S and a molecular weight of 312.41 g/mol. Its IUPAC name is methyl 4-[2-(4-fluorophenyl)sulfanylethoxy]cyclohexane-1-carboxylate.
| Compound Name | methyl 4-[2-(4-fluorophenyl)sulfanylethoxy]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 114450499 |
| Molecular Formula | C16H21FO3S |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | methyl 4-[2-(4-fluorophenyl)sulfanylethoxy]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CCC(OCCSc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C16H21FO3S/c1-19-16(18)12-2-6-14(7-3-12)20-10-11-21-15-8-4-13(17)5-9-15/h4-5,8-9,12,14H,2-3,6-7,10-11H2,1H3 |
| InChIKey | WIHMYXZXZZLKJH-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|