C16H15N3O2 — CID 114456583
1-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl]-2,3-dihydroindol-7-amine (PubChem CID 114456583) has the molecular formula C16H15N3O2 and a molecular weight of 281.31 g/mol. Its IUPAC name is 1-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl]-2,3-dihydroindol-7-amine.
| Compound Name | 1-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl]-2,3-dihydroindol-7-amine |
|---|---|
| PubChem CID | 114456583 |
| Molecular Formula | C16H15N3O2 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 1-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl]-2,3-dihydroindol-7-amine |
| SMILES | Nc1cccc2c1N(Cc1cc(-c3ccco3)on1)CC2 |
| InChI | InChI=1S/C16H15N3O2/c17-13-4-1-3-11-6-7-19(16(11)13)10-12-9-15(21-18-12)14-5-2-8-20-14/h1-5,8-9H,6-7,10,17H2 |
| InChIKey | ZQFRUHIHQLHHFG-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 68.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|