C8H19N3O4S — CID 114461340
ethyl N-[(1-amino-2-methylpropan-2-yl)-methylsulfamoyl]carbamate (PubChem CID 114461340) has the molecular formula C8H19N3O4S and a molecular weight of 253.32 g/mol. Its IUPAC name is ethyl N-[(1-amino-2-methylpropan-2-yl)-methylsulfamoyl]carbamate.
| Compound Name | ethyl N-[(1-amino-2-methylpropan-2-yl)-methylsulfamoyl]carbamate |
|---|---|
| PubChem CID | 114461340 |
| Molecular Formula | C8H19N3O4S |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | ethyl N-[(1-amino-2-methylpropan-2-yl)-methylsulfamoyl]carbamate |
| SMILES | CCOC(=O)NS(=O)(=O)N(C)C(C)(C)CN |
| InChI | InChI=1S/C8H19N3O4S/c1-5-15-7(12)10-16(13,14)11(4)8(2,3)6-9/h5-6,9H2,1-4H3,(H,10,12) |
| InChIKey | MVXUTJDBJATIBH-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |