C11H17N5O4S — CID 114467482
methyl N-[(3-amino-3-iminopropyl)-(pyridin-3-ylmethyl)sulfamoyl]carbamate (PubChem CID 114467482) has the molecular formula C11H17N5O4S and a molecular weight of 315.35 g/mol. Its IUPAC name is methyl N-[(3-amino-3-iminopropyl)-(pyridin-3-ylmethyl)sulfamoyl]carbamate.
| Compound Name | methyl N-[(3-amino-3-iminopropyl)-(pyridin-3-ylmethyl)sulfamoyl]carbamate |
|---|---|
| PubChem CID | 114467482 |
| Molecular Formula | C11H17N5O4S |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | methyl N-[(3-amino-3-iminopropyl)-(pyridin-3-ylmethyl)sulfamoyl]carbamate |
| SMILES | [H]/N=C(\N)CCN(Cc1cccnc1)S(=O)(=O)NC(=O)OC |
| InChI | InChI=1S/C11H17N5O4S/c1-20-11(17)15-21(18,19)16(6-4-10(12)13)8-9-3-2-5-14-7-9/h2-3,5,7H,4,6,8H2,1H3,(H3,12,13)(H,15,17) |
| InChIKey | CZONEIKEEHREEU-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 138.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|