C11H19N5O2S — CID 114813469
3-[ethylsulfamoyl(pyridin-3-ylmethyl)amino]propanimidamide (PubChem CID 114813469) has the molecular formula C11H19N5O2S and a molecular weight of 285.37 g/mol. Its IUPAC name is 3-[ethylsulfamoyl(pyridin-3-ylmethyl)amino]propanimidamide.
| Compound Name | 3-[ethylsulfamoyl(pyridin-3-ylmethyl)amino]propanimidamide |
|---|---|
| PubChem CID | 114813469 |
| Molecular Formula | C11H19N5O2S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 3-[ethylsulfamoyl(pyridin-3-ylmethyl)amino]propanimidamide |
| SMILES | [H]/N=C(\N)CCN(Cc1cccnc1)S(=O)(=O)NCC |
| InChI | InChI=1S/C11H19N5O2S/c1-2-15-19(17,18)16(7-5-11(12)13)9-10-4-3-6-14-8-10/h3-4,6,8,15H,2,5,7,9H2,1H3,(H3,12,13) |
| InChIKey | XIPDXCUXLBUNBQ-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 112.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|