C12H21N5O2S — CID 114813470
3-[propylsulfamoyl(pyridin-3-ylmethyl)amino]propanimidamide (PubChem CID 114813470) has the molecular formula C12H21N5O2S and a molecular weight of 299.40 g/mol. Its IUPAC name is 3-[propylsulfamoyl(pyridin-3-ylmethyl)amino]propanimidamide.
| Compound Name | 3-[propylsulfamoyl(pyridin-3-ylmethyl)amino]propanimidamide |
|---|---|
| PubChem CID | 114813470 |
| Molecular Formula | C12H21N5O2S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 3-[propylsulfamoyl(pyridin-3-ylmethyl)amino]propanimidamide |
| SMILES | [H]/N=C(\N)CCN(Cc1cccnc1)S(=O)(=O)NCCC |
| InChI | InChI=1S/C12H21N5O2S/c1-2-6-16-20(18,19)17(8-5-12(13)14)10-11-4-3-7-15-9-11/h3-4,7,9,16H,2,5-6,8,10H2,1H3,(H3,13,14) |
| InChIKey | VENZUSHDDVAFMZ-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 112.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|