C12H23N — CID 114477529
(3E)-7-methyl-N-propylocta-3,7-dien-1-amine (PubChem CID 114477529) has the molecular formula C12H23N and a molecular weight of 181.32 g/mol. Its IUPAC name is (3E)-7-methyl-N-propylocta-3,7-dien-1-amine.
| Compound Name | (3E)-7-methyl-N-propylocta-3,7-dien-1-amine |
|---|---|
| PubChem CID | 114477529 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | (3E)-7-methyl-N-propylocta-3,7-dien-1-amine |
| SMILES | C=C(C)CC/C=C/CCNCCC |
| InChI | InChI=1S/C12H23N/c1-4-10-13-11-8-6-5-7-9-12(2)3/h5-6,13H,2,4,7-11H2,1,3H3/b6-5+ |
| InChIKey | WUDORLWXVHVXSJ-AATRIKPKSA-N |
| XLogP | 3.29 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|