C16H31N — CID 167244985
(3Z)-9-methyl-N-(3-methylbutyl)deca-3,9-dien-1-amine (PubChem CID 167244985) has the molecular formula C16H31N and a molecular weight of 237.43 g/mol. Its IUPAC name is (3Z)-9-methyl-N-(3-methylbutyl)deca-3,9-dien-1-amine.
| Compound Name | (3Z)-9-methyl-N-(3-methylbutyl)deca-3,9-dien-1-amine |
|---|---|
| PubChem CID | 167244985 |
| Molecular Formula | C16H31N |
| Molecular Weight | 237.43 g/mol |
| Exact Mass | 237.25 |
| IUPAC Name | (3Z)-9-methyl-N-(3-methylbutyl)deca-3,9-dien-1-amine |
| SMILES | C=C(C)CCCC/C=C\CCNCCC(C)C |
| InChI | InChI=1S/C16H31N/c1-15(2)11-9-7-5-6-8-10-13-17-14-12-16(3)4/h6,8,16-17H,1,5,7,9-14H2,2-4H3/b8-6- |
| InChIKey | QRSRKCYKBLTZNH-VURMDHGXSA-N |
| XLogP | 4.70 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.43 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|