C28H50 — CID 140597740
(9E)-2,17-dimethyl-12-(5-methylhex-1-en-2-yl)-14-methylideneoctadeca-1,9-diene (PubChem CID 140597740) has the molecular formula C28H50 and a molecular weight of 386.71 g/mol. Its IUPAC name is (9E)-2,17-dimethyl-12-(5-methylhex-1-en-2-yl)-14-methylideneoctadeca-1,9-diene.
| Compound Name | (9E)-2,17-dimethyl-12-(5-methylhex-1-en-2-yl)-14-methylideneoctadeca-1,9-diene |
|---|---|
| PubChem CID | 140597740 |
| Molecular Formula | C28H50 |
| Molecular Weight | 386.71 g/mol |
| Exact Mass | 386.39 |
| IUPAC Name | (9E)-2,17-dimethyl-12-(5-methylhex-1-en-2-yl)-14-methylideneoctadeca-1,9-diene |
| SMILES | C=C(C)CCCCCC/C=C/CC(CC(=C)CCC(C)C)C(=C)CCC(C)C |
| InChI | InChI=1S/C28H50/c1-23(2)16-14-12-10-9-11-13-15-17-28(27(8)21-19-25(5)6)22-26(7)20-18-24(3)4/h13,15,24-25,28H,1,7-12,14,16-22H2,2-6H3/b15-13+ |
| InChIKey | KQOYOSUSLXHMTJ-FYWRMAATSA-N |
| XLogP | 9.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.71 |
| LogP ≤ 5 | 9.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|