C16H21ClN2OS — CID 114484422
N-[[4-[4-(chloromethyl)-1,3-thiazol-2-yl]-2-methylphenyl]methyl]-2-methoxy-N-methylethanamine (PubChem CID 114484422) has the molecular formula C16H21ClN2OS and a molecular weight of 324.88 g/mol. Its IUPAC name is N-[[4-[4-(chloromethyl)-1,3-thiazol-2-yl]-2-methylphenyl]methyl]-2-methoxy-N-methylethanamine.
| Compound Name | N-[[4-[4-(chloromethyl)-1,3-thiazol-2-yl]-2-methylphenyl]methyl]-2-methoxy-N-methylethanamine |
|---|---|
| PubChem CID | 114484422 |
| Molecular Formula | C16H21ClN2OS |
| Molecular Weight | 324.88 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | N-[[4-[4-(chloromethyl)-1,3-thiazol-2-yl]-2-methylphenyl]methyl]-2-methoxy-N-methylethanamine |
| SMILES | COCCN(C)Cc1ccc(-c2nc(CCl)cs2)cc1C |
| InChI | InChI=1S/C16H21ClN2OS/c1-12-8-13(16-18-15(9-17)11-21-16)4-5-14(12)10-19(2)6-7-20-3/h4-5,8,11H,6-7,9-10H2,1-3H3 |
| InChIKey | DHTVIURTFXMMDG-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.88 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|