C14H18F3N3 — CID 114489517
1-pyridin-2-yl-1-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]propan-2-amine (PubChem CID 114489517) has the molecular formula C14H18F3N3 and a molecular weight of 285.31 g/mol. Its IUPAC name is 1-pyridin-2-yl-1-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]propan-2-amine.
| Compound Name | 1-pyridin-2-yl-1-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]propan-2-amine |
|---|---|
| PubChem CID | 114489517 |
| Molecular Formula | C14H18F3N3 |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 1-pyridin-2-yl-1-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]propan-2-amine |
| SMILES | CC(N)C(c1ccccn1)N1CC=C(C(F)(F)F)CC1 |
| InChI | InChI=1S/C14H18F3N3/c1-10(18)13(12-4-2-3-7-19-12)20-8-5-11(6-9-20)14(15,16)17/h2-5,7,10,13H,6,8-9,18H2,1H3 |
| InChIKey | HEXNHKGLICZWAG-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|