C13H22F3N3O — CID 114489698
N-(3-aminopropyl)-N-methyl-3-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]propanamide (PubChem CID 114489698) has the molecular formula C13H22F3N3O and a molecular weight of 293.33 g/mol. Its IUPAC name is N-(3-aminopropyl)-N-methyl-3-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]propanamide.
| Compound Name | N-(3-aminopropyl)-N-methyl-3-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]propanamide |
|---|---|
| PubChem CID | 114489698 |
| Molecular Formula | C13H22F3N3O |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | N-(3-aminopropyl)-N-methyl-3-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]propanamide |
| SMILES | CN(CCCN)C(=O)CCN1CC=C(C(F)(F)F)CC1 |
| InChI | InChI=1S/C13H22F3N3O/c1-18(7-2-6-17)12(20)5-10-19-8-3-11(4-9-19)13(14,15)16/h3H,2,4-10,17H2,1H3 |
| InChIKey | DGIOEUPPZKYDTO-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|