C10H16F3NO — CID 155723155
ethane;2,2,2-trifluoro-1-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)ethanone (PubChem CID 155723155) has the molecular formula C10H16F3NO and a molecular weight of 223.24 g/mol. Its IUPAC name is ethane;2,2,2-trifluoro-1-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)ethanone.
| Compound Name | ethane;2,2,2-trifluoro-1-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)ethanone |
|---|---|
| PubChem CID | 155723155 |
| Molecular Formula | C10H16F3NO |
| Molecular Weight | 223.24 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | ethane;2,2,2-trifluoro-1-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)ethanone |
| SMILES | CC.CC1=CCN(C(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C8H10F3NO.C2H6/c1-6-2-4-12(5-3-6)7(13)8(9,10)11;1-2/h2H,3-5H2,1H3;1-2H3 |
| InChIKey | OMHRCHVTJRGRIS-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.24 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|