C10H12F6N2O — CID 103310457
3,3,3-trifluoro-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)-2-(trifluoromethyl)propanamide (PubChem CID 103310457) has the molecular formula C10H12F6N2O and a molecular weight of 290.21 g/mol. Its IUPAC name is 3,3,3-trifluoro-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)-2-(trifluoromethyl)propanamide.
| Compound Name | 3,3,3-trifluoro-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)-2-(trifluoromethyl)propanamide |
|---|---|
| PubChem CID | 103310457 |
| Molecular Formula | C10H12F6N2O |
| Molecular Weight | 290.21 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 3,3,3-trifluoro-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)-2-(trifluoromethyl)propanamide |
| SMILES | O=C(NCC1=CCNCC1)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H12F6N2O/c11-9(12,13)7(10(14,15)16)8(19)18-5-6-1-3-17-4-2-6/h1,7,17H,2-5H2,(H,18,19) |
| InChIKey | UVFABSXUFHWRLZ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.21 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|