C11H17F4NO — CID 166470367
ethane;(3E)-5-fluoro-3-methyl-N-(2,2,2-trifluoroethyl)hexa-3,5-dienamide (PubChem CID 166470367) has the molecular formula C11H17F4NO and a molecular weight of 255.25 g/mol. Its IUPAC name is ethane;(3E)-5-fluoro-3-methyl-N-(2,2,2-trifluoroethyl)hexa-3,5-dienamide.
| Compound Name | ethane;(3E)-5-fluoro-3-methyl-N-(2,2,2-trifluoroethyl)hexa-3,5-dienamide |
|---|---|
| PubChem CID | 166470367 |
| Molecular Formula | C11H17F4NO |
| Molecular Weight | 255.25 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | ethane;(3E)-5-fluoro-3-methyl-N-(2,2,2-trifluoroethyl)hexa-3,5-dienamide |
| SMILES | C=C(F)/C=C(\C)CC(=O)NCC(F)(F)F.CC |
| InChI | InChI=1S/C9H11F4NO.C2H6/c1-6(3-7(2)10)4-8(15)14-5-9(11,12)13;1-2/h3H,2,4-5H2,1H3,(H,14,15);1-2H3/b6-3+; |
| InChIKey | ZOJVLRBAYHPGKI-ZIKNSQGESA-N |
| XLogP | 3.51 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.25 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|