C13H20FNO — CID 123441843
3-fluoro-N-propan-2-yl-2-prop-1-en-2-ylhepta-2,4-dienamide (PubChem CID 123441843) has the molecular formula C13H20FNO and a molecular weight of 225.31 g/mol. Its IUPAC name is 3-fluoro-N-propan-2-yl-2-prop-1-en-2-ylhepta-2,4-dienamide.
| Compound Name | 3-fluoro-N-propan-2-yl-2-prop-1-en-2-ylhepta-2,4-dienamide |
|---|---|
| PubChem CID | 123441843 |
| Molecular Formula | C13H20FNO |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | 3-fluoro-N-propan-2-yl-2-prop-1-en-2-ylhepta-2,4-dienamide |
| SMILES | C=C(C)C(C(=O)NC(C)C)=C(F)C=CCC |
| InChI | InChI=1S/C13H20FNO/c1-6-7-8-11(14)12(9(2)3)13(16)15-10(4)5/h7-8,10H,2,6H2,1,3-5H3,(H,15,16) |
| InChIKey | SZSUKAUYIHHCFT-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|