C15H15F6NO — CID 142892627
N-[[3,6-bis(trifluoromethyl)cyclohepta-1,3,6-trien-1-yl]methyl]pent-4-enamide (PubChem CID 142892627) has the molecular formula C15H15F6NO and a molecular weight of 339.28 g/mol. Its IUPAC name is N-[[3,6-bis(trifluoromethyl)cyclohepta-1,3,6-trien-1-yl]methyl]pent-4-enamide.
| Compound Name | N-[[3,6-bis(trifluoromethyl)cyclohepta-1,3,6-trien-1-yl]methyl]pent-4-enamide |
|---|---|
| PubChem CID | 142892627 |
| Molecular Formula | C15H15F6NO |
| Molecular Weight | 339.28 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | N-[[3,6-bis(trifluoromethyl)cyclohepta-1,3,6-trien-1-yl]methyl]pent-4-enamide |
| SMILES | C=CCCC(=O)NCC1=CC(C(F)(F)F)=CCC(C(F)(F)F)=C1 |
| InChI | InChI=1S/C15H15F6NO/c1-2-3-4-13(23)22-9-10-7-11(14(16,17)18)5-6-12(8-10)15(19,20)21/h2,5,7-8H,1,3-4,6,9H2,(H,22,23) |
| InChIKey | WZHHBFVVTNIEQL-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.28 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|