C16H20O4S — CID 11449696
2-[(1R,2S)-2-[(E)-2-(benzenesulfonyl)ethenyl]cyclopropyl]oxyoxane (PubChem CID 11449696) has the molecular formula C16H20O4S and a molecular weight of 308.40 g/mol. Its IUPAC name is 2-[(1R,2S)-2-[(E)-2-(benzenesulfonyl)ethenyl]cyclopropyl]oxyoxane.
| Compound Name | 2-[(1R,2S)-2-[(E)-2-(benzenesulfonyl)ethenyl]cyclopropyl]oxyoxane |
|---|---|
| PubChem CID | 11449696 |
| Molecular Formula | C16H20O4S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 2-[(1R,2S)-2-[(E)-2-(benzenesulfonyl)ethenyl]cyclopropyl]oxyoxane |
| SMILES | O=S(=O)(/C=C/[C@@H]1C[C@H]1OC1CCCCO1)c1ccccc1 |
| InChI | InChI=1S/C16H20O4S/c17-21(18,14-6-2-1-3-7-14)11-9-13-12-15(13)20-16-8-4-5-10-19-16/h1-3,6-7,9,11,13,15-16H,4-5,8,10,12H2/b11-9+/t13-,15-,16?/m1/s1 |
| InChIKey | YXXCYXDXENYKSO-UBYYCTNDSA-N |
| XLogP | 2.91 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |