C9H13N3 — CID 114498094
3-(1,3-dimethylpyrazol-4-yl)-N-methylprop-2-yn-1-amine (PubChem CID 114498094) has the molecular formula C9H13N3 and a molecular weight of 163.22 g/mol. Its IUPAC name is 3-(1,3-dimethylpyrazol-4-yl)-N-methylprop-2-yn-1-amine.
| Compound Name | 3-(1,3-dimethylpyrazol-4-yl)-N-methylprop-2-yn-1-amine |
|---|---|
| PubChem CID | 114498094 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | 3-(1,3-dimethylpyrazol-4-yl)-N-methylprop-2-yn-1-amine |
| SMILES | CNCC#Cc1cn(C)nc1C |
| InChI | InChI=1S/C9H13N3/c1-8-9(5-4-6-10-2)7-12(3)11-8/h7,10H,6H2,1-3H3 |
| InChIKey | LJMFRBPSXVEUKJ-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|