C11H18N2 — CID 114505789
1,3-dimethyl-4-pyrrol-1-ylpiperidine (PubChem CID 114505789) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is 1,3-dimethyl-4-pyrrol-1-ylpiperidine.
| Compound Name | 1,3-dimethyl-4-pyrrol-1-ylpiperidine |
|---|---|
| PubChem CID | 114505789 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | 1,3-dimethyl-4-pyrrol-1-ylpiperidine |
| SMILES | CC1CN(C)CCC1n1cccc1 |
| InChI | InChI=1S/C11H18N2/c1-10-9-12(2)8-5-11(10)13-6-3-4-7-13/h3-4,6-7,10-11H,5,8-9H2,1-2H3 |
| InChIKey | SEVBKBTVZOFZLZ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |