C18H31ClO3Si — CID 11451212
ethyl (E)-6-[(1R,2R)-2-carbonochloridoylcyclopentyl]-2-(trimethylsilylmethyl)hex-2-enoate (PubChem CID 11451212) has the molecular formula C18H31ClO3Si and a molecular weight of 358.98 g/mol. Its IUPAC name is ethyl (E)-6-[(1R,2R)-2-carbonochloridoylcyclopentyl]-2-(trimethylsilylmethyl)hex-2-enoate.
| Compound Name | ethyl (E)-6-[(1R,2R)-2-carbonochloridoylcyclopentyl]-2-(trimethylsilylmethyl)hex-2-enoate |
|---|---|
| PubChem CID | 11451212 |
| Molecular Formula | C18H31ClO3Si |
| Molecular Weight | 358.98 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | ethyl (E)-6-[(1R,2R)-2-carbonochloridoylcyclopentyl]-2-(trimethylsilylmethyl)hex-2-enoate |
| SMILES | CCOC(=O)/C(=C\CCC[C@@H]1CCC[C@H]1C(=O)Cl)C[Si](C)(C)C |
| InChI | InChI=1S/C18H31ClO3Si/c1-5-22-18(21)15(13-23(2,3)4)10-7-6-9-14-11-8-12-16(14)17(19)20/h10,14,16H,5-9,11-13H2,1-4H3/b15-10-/t14-,16-/m1/s1 |
| InChIKey | FMYFDIFQXZRYQK-LQWWUDNOSA-N |
| XLogP | 5.17 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.98 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|