C17H25N3O — CID 114523924
2-(8-amino-3,4-dihydro-1H-isoquinolin-2-yl)-1-(2-methylpiperidin-1-yl)ethanone (PubChem CID 114523924) has the molecular formula C17H25N3O and a molecular weight of 287.41 g/mol. Its IUPAC name is 2-(8-amino-3,4-dihydro-1H-isoquinolin-2-yl)-1-(2-methylpiperidin-1-yl)ethanone.
| Compound Name | 2-(8-amino-3,4-dihydro-1H-isoquinolin-2-yl)-1-(2-methylpiperidin-1-yl)ethanone |
|---|---|
| PubChem CID | 114523924 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | 2-(8-amino-3,4-dihydro-1H-isoquinolin-2-yl)-1-(2-methylpiperidin-1-yl)ethanone |
| SMILES | CC1CCCCN1C(=O)CN1CCc2cccc(N)c2C1 |
| InChI | InChI=1S/C17H25N3O/c1-13-5-2-3-9-20(13)17(21)12-19-10-8-14-6-4-7-16(18)15(14)11-19/h4,6-7,13H,2-3,5,8-12,18H2,1H3 |
| InChIKey | UNRPRDDPKSPEGW-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|