C22H27F2NO4 — CID 11452534
(Z)-7-[(2R)-2-[(E,3R)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-6-oxopiperidin-1-yl]hept-5-enoic acid (PubChem CID 11452534) has the molecular formula C22H27F2NO4 and a molecular weight of 407.46 g/mol. Its IUPAC name is (Z)-7-[(2R)-2-[(E,3R)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-6-oxopiperidin-1-yl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(2R)-2-[(E,3R)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-6-oxopiperidin-1-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 11452534 |
| Molecular Formula | C22H27F2NO4 |
| Molecular Weight | 407.46 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | (Z)-7-[(2R)-2-[(E,3R)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-6-oxopiperidin-1-yl]hept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C\CN1C(=O)CCC[C@@H]1/C=C/[C@@H](O)C(F)(F)c1ccccc1 |
| InChI | InChI=1S/C22H27F2NO4/c23-22(24,17-9-4-3-5-10-17)19(26)15-14-18-11-8-12-20(27)25(18)16-7-2-1-6-13-21(28)29/h2-5,7,9-10,14-15,18-19,26H,1,6,8,11-13,16H2,(H,28,29)/b7-2-,15-14+/t18-,19-/m1/s1 |
| InChIKey | QFCZIIULIYGUEQ-JFCQQCJESA-N |
| XLogP | 3.89 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.46 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|