About (4-methoxyphenyl)-triphenylboranuide;tetramethylazanium
(4-methoxyphenyl)-triphenylboranuide;tetramethylazanium (PubChem CID 11452981) has the molecular formula C29H34BNO
and a molecular weight of 423.41 g/mol. Its IUPAC name is (4-methoxyphenyl)-triphenylboranuide;tetramethylazanium.
Molecular Properties
| Compound Name | (4-methoxyphenyl)-triphenylboranuide;tetramethylazanium |
| PubChem CID | 11452981 |
| Molecular Formula | C29H34BNO |
| Molecular Weight | 423.41 g/mol |
| Exact Mass | 423.27 |
| IUPAC Name | (4-methoxyphenyl)-triphenylboranuide;tetramethylazanium |
| SMILES | COc1ccc([B-](c2ccccc2)(c2ccccc2)c2ccccc2)cc1.C[N+](C)(C)C |
| InChI | InChI=1S/C25H22BO.C4H12N/c1-27-25-19-17-24(18-20-25)26(21-11-5-2-6-12-21,22-13-7-3-8-14-22)23-15-9-4-10-16-23;1-5(2,3)4/h2-20H,1H3;1-4H3/q-1;+1 |
| InChIKey | XPOKFKABTMWZJQ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.41 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze (4-methoxyphenyl)-triphenylboranuide;tetramethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methoxyphenyl)-triphenylboranuide;tetramethylazanium?
The IUPAC name of (4-methoxyphenyl)-triphenylboranuide;tetramethylazanium (CID 11452981) is (4-methoxyphenyl)-triphenylboranuide;tetramethylazanium.
What is the SMILES notation for (4-methoxyphenyl)-triphenylboranuide;tetramethylazanium?
The canonical SMILES for (4-methoxyphenyl)-triphenylboranuide;tetramethylazanium is COc1ccc([B-](c2ccccc2)(c2ccccc2)c2ccccc2)cc1.C[N+](C)(C)C.
What is the InChIKey of (4-methoxyphenyl)-triphenylboranuide;tetramethylazanium?
The InChIKey is XPOKFKABTMWZJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H22BO.C4H12N/c1-27-25-19-17-24(18-20-25)26(21-11-5-2-6-12-21,22-13-7-3-8-14-22)23-15-9-4-10-16-23;1-5(2,3)4/h2-20H,1H3;1-4H3/q-1;+1.
What are the key properties of (4-methoxyphenyl)-triphenylboranuide;tetramethylazanium?
(4-methoxyphenyl)-triphenylboranuide;tetramethylazanium has a molecular weight of 423.41 g/mol, XLogP of 3.39, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methoxyphenyl)-triphenylboranuide;tetramethylazanium is sourced from PubChem (CID 11452981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).