C32H32BO2P — CID 175358048
(3,5-dimethoxyphenyl)phosphanium;tetraphenylboranuide (PubChem CID 175358048) has the molecular formula C32H32BO2P and a molecular weight of 490.39 g/mol. Its IUPAC name is (3,5-dimethoxyphenyl)phosphanium;tetraphenylboranuide.
| Compound Name | (3,5-dimethoxyphenyl)phosphanium;tetraphenylboranuide |
|---|---|
| PubChem CID | 175358048 |
| Molecular Formula | C32H32BO2P |
| Molecular Weight | 490.39 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | (3,5-dimethoxyphenyl)phosphanium;tetraphenylboranuide |
| SMILES | COc1cc([PH3+])cc(OC)c1.c1ccc([B-](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H20B.C8H11O2P/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;1-9-6-3-7(10-2)5-8(11)4-6/h1-20H;3-5H,11H2,1-2H3/q-1;/p+1 |
| InChIKey | AZLOVSCNAVMFLK-UHFFFAOYSA-O |
| XLogP | 4.00 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.39 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|