C23H21Cl2N3O — CID 11453058
2,3-bis(2-chlorophenyl)-5-cyclohexyl-6H-pyrrolo[3,4-c]pyrazol-4-one (PubChem CID 11453058) has the molecular formula C23H21Cl2N3O and a molecular weight of 426.35 g/mol. Its IUPAC name is 2,3-bis(2-chlorophenyl)-5-cyclohexyl-6H-pyrrolo[3,4-c]pyrazol-4-one.
| Compound Name | 2,3-bis(2-chlorophenyl)-5-cyclohexyl-6H-pyrrolo[3,4-c]pyrazol-4-one |
|---|---|
| PubChem CID | 11453058 |
| Molecular Formula | C23H21Cl2N3O |
| Molecular Weight | 426.35 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | 2,3-bis(2-chlorophenyl)-5-cyclohexyl-6H-pyrrolo[3,4-c]pyrazol-4-one |
| SMILES | O=C1c2c(nn(-c3ccccc3Cl)c2-c2ccccc2Cl)CN1C1CCCCC1 |
| InChI | InChI=1S/C23H21Cl2N3O/c24-17-11-5-4-10-16(17)22-21-19(26-28(22)20-13-7-6-12-18(20)25)14-27(23(21)29)15-8-2-1-3-9-15/h4-7,10-13,15H,1-3,8-9,14H2 |
| InChIKey | PWYNDSQYOYCOQM-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.35 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |