C14H17FO4 — CID 114533664
3-[(3-fluoro-4-methoxyphenyl)methyl]-2-methyloxolane-3-carboxylic acid (PubChem CID 114533664) has the molecular formula C14H17FO4 and a molecular weight of 268.28 g/mol. Its IUPAC name is 3-[(3-fluoro-4-methoxyphenyl)methyl]-2-methyloxolane-3-carboxylic acid.
| Compound Name | 3-[(3-fluoro-4-methoxyphenyl)methyl]-2-methyloxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 114533664 |
| Molecular Formula | C14H17FO4 |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 3-[(3-fluoro-4-methoxyphenyl)methyl]-2-methyloxolane-3-carboxylic acid |
| SMILES | COc1ccc(CC2(C(=O)O)CCOC2C)cc1F |
| InChI | InChI=1S/C14H17FO4/c1-9-14(13(16)17,5-6-19-9)8-10-3-4-12(18-2)11(15)7-10/h3-4,7,9H,5-6,8H2,1-2H3,(H,16,17) |
| InChIKey | LPWUJAZECMTNNB-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |