C31H49BSi — CID 11453968
[(E)-3-[bis[(1S,2R,3S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]boranyl]prop-1-enyl]-dimethyl-phenylsilane (PubChem CID 11453968) has the molecular formula C31H49BSi and a molecular weight of 460.63 g/mol. Its IUPAC name is [(E)-3-[bis[(1S,2R,3S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]boranyl]prop-1-enyl]-dimethyl-phenylsilane.
| Compound Name | [(E)-3-[bis[(1S,2R,3S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]boranyl]prop-1-enyl]-dimethyl-phenylsilane |
|---|---|
| PubChem CID | 11453968 |
| Molecular Formula | C31H49BSi |
| Molecular Weight | 460.63 g/mol |
| Exact Mass | 460.37 |
| IUPAC Name | [(E)-3-[bis[(1S,2R,3S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]boranyl]prop-1-enyl]-dimethyl-phenylsilane |
| SMILES | C[C@@H]1[C@@H](B(C/C=C/[Si](C)(C)c2ccccc2)[C@H]2C[C@H]3C[C@@H]([C@@H]2C)C3(C)C)C[C@H]2C[C@@H]1C2(C)C |
| InChI | InChI=1S/C31H49BSi/c1-21-26-17-23(30(26,3)4)19-28(21)32(29-20-24-18-27(22(29)2)31(24,5)6)15-12-16-33(7,8)25-13-10-9-11-14-25/h9-14,16,21-24,26-29H,15,17-20H2,1-8H3/b16-12+/t21-,22-,23+,24+,26-,27-,28-,29-/m0/s1 |
| InChIKey | WRAKNHHYOTVUDL-WNNPNDOHSA-N |
| XLogP | 8.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.63 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|