C15H18F3N3 — CID 114541155
1-(3,3-dimethylcyclopentyl)-2-(trifluoromethyl)benzimidazol-5-amine (PubChem CID 114541155) has the molecular formula C15H18F3N3 and a molecular weight of 297.32 g/mol. Its IUPAC name is 1-(3,3-dimethylcyclopentyl)-2-(trifluoromethyl)benzimidazol-5-amine.
| Compound Name | 1-(3,3-dimethylcyclopentyl)-2-(trifluoromethyl)benzimidazol-5-amine |
|---|---|
| PubChem CID | 114541155 |
| Molecular Formula | C15H18F3N3 |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 1-(3,3-dimethylcyclopentyl)-2-(trifluoromethyl)benzimidazol-5-amine |
| SMILES | CC1(C)CCC(n2c(C(F)(F)F)nc3cc(N)ccc32)C1 |
| InChI | InChI=1S/C15H18F3N3/c1-14(2)6-5-10(8-14)21-12-4-3-9(19)7-11(12)20-13(21)15(16,17)18/h3-4,7,10H,5-6,8,19H2,1-2H3 |
| InChIKey | XHGBIZUQDXGZHI-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|