C28H40O4S — CID 11454264
[4-[3-[4-[2-(1-hydroxycyclopentyl)propyl]-3-methylphenyl]pentan-3-yl]-2-methylphenyl] methanesulfonate (PubChem CID 11454264) has the molecular formula C28H40O4S and a molecular weight of 472.69 g/mol. Its IUPAC name is [4-[3-[4-[2-(1-hydroxycyclopentyl)propyl]-3-methylphenyl]pentan-3-yl]-2-methylphenyl] methanesulfonate.
| Compound Name | [4-[3-[4-[2-(1-hydroxycyclopentyl)propyl]-3-methylphenyl]pentan-3-yl]-2-methylphenyl] methanesulfonate |
|---|---|
| PubChem CID | 11454264 |
| Molecular Formula | C28H40O4S |
| Molecular Weight | 472.69 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | [4-[3-[4-[2-(1-hydroxycyclopentyl)propyl]-3-methylphenyl]pentan-3-yl]-2-methylphenyl] methanesulfonate |
| SMILES | CCC(CC)(c1ccc(CC(C)C2(O)CCCC2)c(C)c1)c1ccc(OS(C)(=O)=O)c(C)c1 |
| InChI | InChI=1S/C28H40O4S/c1-7-27(8-2,25-13-14-26(21(4)18-25)32-33(6,30)31)24-12-11-23(20(3)17-24)19-22(5)28(29)15-9-10-16-28/h11-14,17-18,22,29H,7-10,15-16,19H2,1-6H3 |
| InChIKey | OYEXUHJCIXPTCO-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.69 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|