About [4-[3-[4-(4-hydroxy-2,4-dimethylhexyl)phenyl]pentan-3-yl]-2-methylphenyl] methanesulfonate
[4-[3-[4-(4-hydroxy-2,4-dimethylhexyl)phenyl]pentan-3-yl]-2-methylphenyl] methanesulfonate (PubChem CID 11213346) has the molecular formula C27H40O4S
and a molecular weight of 460.68 g/mol. Its IUPAC name is [4-[3-[4-(4-hydroxy-2,4-dimethylhexyl)phenyl]pentan-3-yl]-2-methylphenyl] methanesulfonate.
Molecular Properties
| Compound Name | [4-[3-[4-(4-hydroxy-2,4-dimethylhexyl)phenyl]pentan-3-yl]-2-methylphenyl] methanesulfonate |
| PubChem CID | 11213346 |
| Molecular Formula | C27H40O4S |
| Molecular Weight | 460.68 g/mol |
| Exact Mass | 460.26 |
| IUPAC Name | [4-[3-[4-(4-hydroxy-2,4-dimethylhexyl)phenyl]pentan-3-yl]-2-methylphenyl] methanesulfonate |
| SMILES | CCC(C)(O)CC(C)Cc1ccc(C(CC)(CC)c2ccc(OS(C)(=O)=O)c(C)c2)cc1 |
| InChI | InChI=1S/C27H40O4S/c1-8-26(6,28)19-20(4)17-22-11-13-23(14-12-22)27(9-2,10-3)24-15-16-25(21(5)18-24)31-32(7,29)30/h11-16,18,20,28H,8-10,17,19H2,1-7H3 |
| InChIKey | RCYGFPZHXHFVSP-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 460.68 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [4-[3-[4-(4-hydroxy-2,4-dimethylhexyl)phenyl]pentan-3-yl]-2-methylphenyl] methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[3-[4-(4-hydroxy-2,4-dimethylhexyl)phenyl]pentan-3-yl]-2-methylphenyl] methanesulfonate?
The IUPAC name of [4-[3-[4-(4-hydroxy-2,4-dimethylhexyl)phenyl]pentan-3-yl]-2-methylphenyl] methanesulfonate (CID 11213346) is [4-[3-[4-(4-hydroxy-2,4-dimethylhexyl)phenyl]pentan-3-yl]-2-methylphenyl] methanesulfonate.
What is the SMILES notation for [4-[3-[4-(4-hydroxy-2,4-dimethylhexyl)phenyl]pentan-3-yl]-2-methylphenyl] methanesulfonate?
The canonical SMILES for [4-[3-[4-(4-hydroxy-2,4-dimethylhexyl)phenyl]pentan-3-yl]-2-methylphenyl] methanesulfonate is CCC(C)(O)CC(C)Cc1ccc(C(CC)(CC)c2ccc(OS(C)(=O)=O)c(C)c2)cc1.
What is the InChIKey of [4-[3-[4-(4-hydroxy-2,4-dimethylhexyl)phenyl]pentan-3-yl]-2-methylphenyl] methanesulfonate?
The InChIKey is RCYGFPZHXHFVSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H40O4S/c1-8-26(6,28)19-20(4)17-22-11-13-23(14-12-22)27(9-2,10-3)24-15-16-25(21(5)18-24)31-32(7,29)30/h11-16,18,20,28H,8-10,17,19H2,1-7H3.
What are the key properties of [4-[3-[4-(4-hydroxy-2,4-dimethylhexyl)phenyl]pentan-3-yl]-2-methylphenyl] methanesulfonate?
[4-[3-[4-(4-hydroxy-2,4-dimethylhexyl)phenyl]pentan-3-yl]-2-methylphenyl] methanesulfonate has a molecular weight of 460.68 g/mol, XLogP of 6.17, 11 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[3-[4-(4-hydroxy-2,4-dimethylhexyl)phenyl]pentan-3-yl]-2-methylphenyl] methanesulfonate is sourced from PubChem (CID 11213346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).