C25H28ClFN4O2S — CID 11454888
N-[1-[(2-chloro-6-fluorophenyl)methyl]pyrrolidin-3-yl]-2-[[(2E,4E)-hexa-2,4-dienoyl]amino]-4,5,6,7-tetrahydro-1,3-benzothiazole-4-carboxamide (PubChem CID 11454888) has the molecular formula C25H28ClFN4O2S and a molecular weight of 503.04 g/mol. Its IUPAC name is N-[1-[(2-chloro-6-fluorophenyl)methyl]pyrrolidin-3-yl]-2-[[(2E,4E)-hexa-2,4-dienoyl]amino]-4,5,6,7-tetrahydro-1,3-benzothiazole-4-carboxamide.
| Compound Name | N-[1-[(2-chloro-6-fluorophenyl)methyl]pyrrolidin-3-yl]-2-[[(2E,4E)-hexa-2,4-dienoyl]amino]-4,5,6,7-tetrahydro-1,3-benzothiazole-4-carboxamide |
|---|---|
| PubChem CID | 11454888 |
| Molecular Formula | C25H28ClFN4O2S |
| Molecular Weight | 503.04 g/mol |
| Exact Mass | 502.16 |
| IUPAC Name | N-[1-[(2-chloro-6-fluorophenyl)methyl]pyrrolidin-3-yl]-2-[[(2E,4E)-hexa-2,4-dienoyl]amino]-4,5,6,7-tetrahydro-1,3-benzothiazole-4-carboxamide |
| SMILES | C/C=C/C=C/C(=O)Nc1nc2c(s1)CCCC2C(=O)NC1CCN(Cc2c(F)cccc2Cl)C1 |
| InChI | InChI=1S/C25H28ClFN4O2S/c1-2-3-4-11-22(32)29-25-30-23-17(7-5-10-21(23)34-25)24(33)28-16-12-13-31(14-16)15-18-19(26)8-6-9-20(18)27/h2-4,6,8-9,11,16-17H,5,7,10,12-15H2,1H3,(H,28,33)(H,29,30,32)/b3-2+,11-4+ |
| InChIKey | FGUVSWRIKWHCRN-TTWWKFCBSA-N |
| XLogP | 4.82 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.04 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|