C34H26Br4O5 — CID 11457138
[(1R,2S,3R,4R,5R)-2,5-bis(4-bromobenzoyl)-3-(4-bromophenyl)-4-ethoxy-3-hydroxycyclopentyl]-(4-bromophenyl)methanone (PubChem CID 11457138) has the molecular formula C34H26Br4O5 and a molecular weight of 834.19 g/mol. Its IUPAC name is [(1R,2S,3R,4R,5R)-2,5-bis(4-bromobenzoyl)-3-(4-bromophenyl)-4-ethoxy-3-hydroxycyclopentyl]-(4-bromophenyl)methanone.
| Compound Name | [(1R,2S,3R,4R,5R)-2,5-bis(4-bromobenzoyl)-3-(4-bromophenyl)-4-ethoxy-3-hydroxycyclopentyl]-(4-bromophenyl)methanone |
|---|---|
| PubChem CID | 11457138 |
| Molecular Formula | C34H26Br4O5 |
| Molecular Weight | 834.19 g/mol |
| Exact Mass | 829.85 |
| IUPAC Name | [(1R,2S,3R,4R,5R)-2,5-bis(4-bromobenzoyl)-3-(4-bromophenyl)-4-ethoxy-3-hydroxycyclopentyl]-(4-bromophenyl)methanone |
| SMILES | CCO[C@@H]1[C@H](C(=O)c2ccc(Br)cc2)[C@@H](C(=O)c2ccc(Br)cc2)[C@H](C(=O)c2ccc(Br)cc2)[C@@]1(O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C34H26Br4O5/c1-2-43-33-28(31(40)20-5-13-24(36)14-6-20)27(30(39)19-3-11-23(35)12-4-19)29(32(41)21-7-15-25(37)16-8-21)34(33,42)22-9-17-26(38)18-10-22/h3-18,27-29,33,42H,2H2,1H3/t27-,28+,29-,33-,34+/m1/s1 |
| InChIKey | QOBBLJGAFWSIOE-SSZRAVJVSA-N |
| XLogP | 8.84 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 834.19 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |