C25H20Br2O3 — CID 122230868
[(2R,3S)-2,3-bis(4-bromophenyl)-2,3-dihydroxy-5-methylidenecyclopentyl]-phenylmethanone (PubChem CID 122230868) has the molecular formula C25H20Br2O3 and a molecular weight of 528.24 g/mol. Its IUPAC name is [(2R,3S)-2,3-bis(4-bromophenyl)-2,3-dihydroxy-5-methylidenecyclopentyl]-phenylmethanone.
| Compound Name | [(2R,3S)-2,3-bis(4-bromophenyl)-2,3-dihydroxy-5-methylidenecyclopentyl]-phenylmethanone |
|---|---|
| PubChem CID | 122230868 |
| Molecular Formula | C25H20Br2O3 |
| Molecular Weight | 528.24 g/mol |
| Exact Mass | 525.98 |
| IUPAC Name | [(2R,3S)-2,3-bis(4-bromophenyl)-2,3-dihydroxy-5-methylidenecyclopentyl]-phenylmethanone |
| SMILES | C=C1C[C@](O)(c2ccc(Br)cc2)[C@](O)(c2ccc(Br)cc2)C1C(=O)c1ccccc1 |
| InChI | InChI=1S/C25H20Br2O3/c1-16-15-24(29,18-7-11-20(26)12-8-18)25(30,19-9-13-21(27)14-10-19)22(16)23(28)17-5-3-2-4-6-17/h2-14,22,29-30H,1,15H2/t22?,24-,25-/m0/s1 |
| InChIKey | SGSPIPMESDRHFE-GARJWBAXSA-N |
| XLogP | 5.75 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.24 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|