C33H30O3 — CID 122230860
[(2R,3S)-2,3-dihydroxy-5-methylidene-2,3-bis(4-methylphenyl)cyclopentyl]-(4-phenylphenyl)methanone (PubChem CID 122230860) has the molecular formula C33H30O3 and a molecular weight of 474.60 g/mol. Its IUPAC name is [(2R,3S)-2,3-dihydroxy-5-methylidene-2,3-bis(4-methylphenyl)cyclopentyl]-(4-phenylphenyl)methanone.
| Compound Name | [(2R,3S)-2,3-dihydroxy-5-methylidene-2,3-bis(4-methylphenyl)cyclopentyl]-(4-phenylphenyl)methanone |
|---|---|
| PubChem CID | 122230860 |
| Molecular Formula | C33H30O3 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | [(2R,3S)-2,3-dihydroxy-5-methylidene-2,3-bis(4-methylphenyl)cyclopentyl]-(4-phenylphenyl)methanone |
| SMILES | C=C1C[C@](O)(c2ccc(C)cc2)[C@](O)(c2ccc(C)cc2)C1C(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C33H30O3/c1-22-9-17-28(18-10-22)32(35)21-24(3)30(33(32,36)29-19-11-23(2)12-20-29)31(34)27-15-13-26(14-16-27)25-7-5-4-6-8-25/h4-20,30,35-36H,3,21H2,1-2H3/t30?,32-,33-/m0/s1 |
| InChIKey | TVSVPCRDUQDQKT-OUGUWIJHSA-N |
| XLogP | 6.50 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|