C11H4ClF7N2 — CID 114589434
4-chloro-2-(1,1,2,2-tetrafluoroethyl)-7-(trifluoromethyl)quinazoline (PubChem CID 114589434) has the molecular formula C11H4ClF7N2 and a molecular weight of 332.61 g/mol. Its IUPAC name is 4-chloro-2-(1,1,2,2-tetrafluoroethyl)-7-(trifluoromethyl)quinazoline.
| Compound Name | 4-chloro-2-(1,1,2,2-tetrafluoroethyl)-7-(trifluoromethyl)quinazoline |
|---|---|
| PubChem CID | 114589434 |
| Molecular Formula | C11H4ClF7N2 |
| Molecular Weight | 332.61 g/mol |
| Exact Mass | 332.00 |
| IUPAC Name | 4-chloro-2-(1,1,2,2-tetrafluoroethyl)-7-(trifluoromethyl)quinazoline |
| SMILES | FC(F)C(F)(F)c1nc(Cl)c2ccc(C(F)(F)F)cc2n1 |
| InChI | InChI=1S/C11H4ClF7N2/c12-7-5-2-1-4(11(17,18)19)3-6(5)20-9(21-7)10(15,16)8(13)14/h1-3,8H |
| InChIKey | YPHVRNNKLCCKLP-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.61 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|