C10H3BrClF5N2 — CID 114590811
8-bromo-4-chloro-2-(1,1,2,2,2-pentafluoroethyl)quinazoline (PubChem CID 114590811) has the molecular formula C10H3BrClF5N2 and a molecular weight of 361.50 g/mol. Its IUPAC name is 8-bromo-4-chloro-2-(1,1,2,2,2-pentafluoroethyl)quinazoline.
| Compound Name | 8-bromo-4-chloro-2-(1,1,2,2,2-pentafluoroethyl)quinazoline |
|---|---|
| PubChem CID | 114590811 |
| Molecular Formula | C10H3BrClF5N2 |
| Molecular Weight | 361.50 g/mol |
| Exact Mass | 359.91 |
| IUPAC Name | 8-bromo-4-chloro-2-(1,1,2,2,2-pentafluoroethyl)quinazoline |
| SMILES | FC(F)(F)C(F)(F)c1nc(Cl)c2cccc(Br)c2n1 |
| InChI | InChI=1S/C10H3BrClF5N2/c11-5-3-1-2-4-6(5)18-8(19-7(4)12)9(13,14)10(15,16)17/h1-3H |
| InChIKey | UJVMMJTZXYSQOZ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.50 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|