C11H23NO2S — CID 114597504
2,3,5-trimethyl-1-propan-2-ylsulfonylpiperidine (PubChem CID 114597504) has the molecular formula C11H23NO2S and a molecular weight of 233.38 g/mol. Its IUPAC name is 2,3,5-trimethyl-1-propan-2-ylsulfonylpiperidine.
| Compound Name | 2,3,5-trimethyl-1-propan-2-ylsulfonylpiperidine |
|---|---|
| PubChem CID | 114597504 |
| Molecular Formula | C11H23NO2S |
| Molecular Weight | 233.38 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 2,3,5-trimethyl-1-propan-2-ylsulfonylpiperidine |
| SMILES | CC1CC(C)C(C)N(S(=O)(=O)C(C)C)C1 |
| InChI | InChI=1S/C11H23NO2S/c1-8(2)15(13,14)12-7-9(3)6-10(4)11(12)5/h8-11H,6-7H2,1-5H3 |
| InChIKey | QJZJWMJTUFIUSF-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.38 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |