C9H18BrNO2S — CID 114594667
1-(bromomethylsulfonyl)-2,3,5-trimethylpiperidine (PubChem CID 114594667) has the molecular formula C9H18BrNO2S and a molecular weight of 284.22 g/mol. Its IUPAC name is 1-(bromomethylsulfonyl)-2,3,5-trimethylpiperidine.
| Compound Name | 1-(bromomethylsulfonyl)-2,3,5-trimethylpiperidine |
|---|---|
| PubChem CID | 114594667 |
| Molecular Formula | C9H18BrNO2S |
| Molecular Weight | 284.22 g/mol |
| Exact Mass | 283.02 |
| IUPAC Name | 1-(bromomethylsulfonyl)-2,3,5-trimethylpiperidine |
| SMILES | CC1CC(C)C(C)N(S(=O)(=O)CBr)C1 |
| InChI | InChI=1S/C9H18BrNO2S/c1-7-4-8(2)9(3)11(5-7)14(12,13)6-10/h7-9H,4-6H2,1-3H3 |
| InChIKey | CEIHPPRFGUIQJA-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.22 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|