C12H12ClNO2S — CID 114604363
4-chloro-1-(1-thiophen-3-ylpropan-2-yl)pyrrole-2-carboxylic acid (PubChem CID 114604363) has the molecular formula C12H12ClNO2S and a molecular weight of 269.75 g/mol. Its IUPAC name is 4-chloro-1-(1-thiophen-3-ylpropan-2-yl)pyrrole-2-carboxylic acid.
| Compound Name | 4-chloro-1-(1-thiophen-3-ylpropan-2-yl)pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 114604363 |
| Molecular Formula | C12H12ClNO2S |
| Molecular Weight | 269.75 g/mol |
| Exact Mass | 269.03 |
| IUPAC Name | 4-chloro-1-(1-thiophen-3-ylpropan-2-yl)pyrrole-2-carboxylic acid |
| SMILES | CC(Cc1ccsc1)n1cc(Cl)cc1C(=O)O |
| InChI | InChI=1S/C12H12ClNO2S/c1-8(4-9-2-3-17-7-9)14-6-10(13)5-11(14)12(15)16/h2-3,5-8H,4H2,1H3,(H,15,16) |
| InChIKey | KHUXUBJXRLGILM-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.75 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |