C16H20ClNOS — CID 61477723
2-chloro-1-[2,5-dimethyl-1-(1-thiophen-3-ylpropan-2-yl)pyrrol-3-yl]propan-1-one (PubChem CID 61477723) has the molecular formula C16H20ClNOS and a molecular weight of 309.86 g/mol. Its IUPAC name is 2-chloro-1-[2,5-dimethyl-1-(1-thiophen-3-ylpropan-2-yl)pyrrol-3-yl]propan-1-one.
| Compound Name | 2-chloro-1-[2,5-dimethyl-1-(1-thiophen-3-ylpropan-2-yl)pyrrol-3-yl]propan-1-one |
|---|---|
| PubChem CID | 61477723 |
| Molecular Formula | C16H20ClNOS |
| Molecular Weight | 309.86 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 2-chloro-1-[2,5-dimethyl-1-(1-thiophen-3-ylpropan-2-yl)pyrrol-3-yl]propan-1-one |
| SMILES | Cc1cc(C(=O)C(C)Cl)c(C)n1C(C)Cc1ccsc1 |
| InChI | InChI=1S/C16H20ClNOS/c1-10(7-14-5-6-20-9-14)18-11(2)8-15(13(18)4)16(19)12(3)17/h5-6,8-10,12H,7H2,1-4H3 |
| InChIKey | UJUJTOLDABRIPF-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.86 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|